EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:88063 - 1,2,4-butanetriol
| Formula | C4H10O3 |
| Net Charge | 0 |
| Average Mass | 106.121 |
| Monoisotopic Mass | 106.06299 |
| SMILES | OCCC(O)CO |
| InChI | InChI=1S/C4H10O3/c5-2-1-4(7)3-6/h4-7H,1-3H2 |
| InChIKey | ARXKVVRQIIOZGF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS226) | ||
| - | PubMed (26175011) | ||
| Escherichia coli BL21 (ncbitaxon:511693) | - | PubMed (26670289) | Strain: BL21 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,4-butanetriol (CHEBI:88063) has parent hydride butane (CHEBI:37808) |
| 1,2,4-butanetriol (CHEBI:88063) has role Escherichia coli metabolite (CHEBI:76971) |
| 1,2,4-butanetriol (CHEBI:88063) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 1,2,4-butanetriol (CHEBI:88063) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| butane-1,2,4-triol |
| Synonyms | Source |
|---|---|
| 1,3,4-Butanetriol | ChemIDplus |
| 1,2,4-Trihydroxybutane | ChemIDplus |
| 1,2,4-Butantriol | ChemIDplus |
| Citations |
|---|