EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36N2O4 |
| Net Charge | 0 |
| Average Mass | 452.595 |
| Monoisotopic Mass | 452.26751 |
| SMILES | CCOc1cc(CC(=O)N[C@@H](CC(C)C)c2ccccc2N2CCCCC2)ccc1C(=O)O |
| InChI | InChI=1S/C27H36N2O4/c1-4-33-25-17-20(12-13-22(25)27(31)32)18-26(30)28-23(16-19(2)3)21-10-6-7-11-24(21)29-14-8-5-9-15-29/h6-7,10-13,17,19,23H,4-5,8-9,14-16,18H2,1-3H3,(H,28,30)(H,31,32)/t23-/m0/s1 |
| InChIKey | FAEKWTJYAYMJKF-QHCPKHFHSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. hypoglycemic agent A drug which lowers the blood glucose level. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antiparkinson drug A drug used in the treatment of Parkinson's disease. antirheumatic drug A drug used to treat rheumatoid arthritis. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Repaglinide (CHEBI:8805) has role anti-anaemic agent (CHEBI:75835) |
| Repaglinide (CHEBI:8805) has role antiatherosclerotic agent (CHEBI:145947) |
| Repaglinide (CHEBI:8805) has role antihypertensive agent (CHEBI:35674) |
| Repaglinide (CHEBI:8805) has role antimalarial (CHEBI:38068) |
| Repaglinide (CHEBI:8805) has role antineoplastic agent (CHEBI:35610) |
| Repaglinide (CHEBI:8805) has role antiparkinson drug (CHEBI:48407) |
| Repaglinide (CHEBI:8805) has role antirheumatic drug (CHEBI:35842) |
| Repaglinide (CHEBI:8805) has role cardiovascular drug (CHEBI:35554) |
| Repaglinide (CHEBI:8805) has role hypoglycemic agent (CHEBI:35526) |
| Repaglinide (CHEBI:8805) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| repaglinida | WHO MedNet |
| Synonyms | Source |
|---|---|
| A10BX02 | ChEMBL |
| AG-EE 623 ZW | ChEMBL |
| AG-EE-623-ZW | ChEMBL |
| AG-EE-623ZW | ChEMBL |
| AGEE-623ZW | ChEMBL |
| enyglid | DrugCentral |
| Brand Names | Source |
|---|---|
| Novonorm | ChEMBL |
| Prandin | ChEMBL |
| Repaglinide accord | ChEMBL |
| Repaglinide component of prandimet | ChEMBL |
| Repaglinide krka | ChEMBL |
| Repaglinide teva | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2366 | DrugCentral |
| C07670 | KEGG COMPOUND |
| D00594 | KEGG DRUG |
| HMDB0015048 | HMDB |
| LSM-3863 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:135062-02-1 | KEGG COMPOUND |
| Citations |
|---|