EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N5O7S |
| Net Charge | 0 |
| Average Mass | 415.428 |
| Monoisotopic Mass | 415.11617 |
| SMILES | [H][C@@]12C[C@H](OS(=O)(=O)O)[C@H](C)[C@@]3([H])CN=C(N[C@@]([H])([C@@H](O)c4cc(=O)nc(=O)n4)C1)N23 |
| InChI | InChI=1S/C15H21N5O7S/c1-6-10-5-16-14-17-8(13(22)9-4-12(21)19-15(23)18-9)2-7(20(10)14)3-11(6)27-28(24,25)26/h4,6-8,10-11,13,22H,2-3,5H2,1H3,(H,16,17)(H,24,25,26)(H2,18,19,21,23)/t6-,7+,8-,10-,11+,13-/m1/s1 |
| InChIKey | LHJPHMKIGRLKDR-VDPNAHCISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aphanizomenon ovalisporum (ncbitaxon:75695) | - | PubMed (10757726) | |
| Cylindrospermopsis raciborskii (ncbitaxon:77022) | - | PubMed (14559084) | |
| Oscillatoria sp. (ncbitaxon:1159) | - | PubMed (20525864) | Strain: PCC 6506 |
| Roles Classification |
|---|
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. cyanotoxin Any toxin produced by cyanobacteria (blue-green algae). genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cylindrospermopsin (CHEBI:88046) has role cyanotoxin (CHEBI:88048) |
| cylindrospermopsin (CHEBI:88046) has role genotoxin (CHEBI:50902) |
| cylindrospermopsin (CHEBI:88046) has role hepatotoxic agent (CHEBI:50908) |
| cylindrospermopsin (CHEBI:88046) has role protein synthesis inhibitor (CHEBI:48001) |
| cylindrospermopsin (CHEBI:88046) is a alkaloid (CHEBI:22315) |
| cylindrospermopsin (CHEBI:88046) is a cylindrospermopsins (CHEBI:88045) |
| cylindrospermopsin (CHEBI:88046) is a organic sulfate (CHEBI:25704) |
| cylindrospermopsin (CHEBI:88046) is a pyrimidone (CHEBI:38337) |
| cylindrospermopsin (CHEBI:88046) is a secondary alcohol (CHEBI:35681) |
| cylindrospermopsin (CHEBI:88046) is a triazaacenaphthylene (CHEBI:88047) |
| cylindrospermopsin (CHEBI:88046) is tautomer of cylindrospermopsin zwitterion (CHEBI:88044) |
| Incoming Relation(s) |
| cylindrospermopsin zwitterion (CHEBI:88044) is tautomer of cylindrospermopsin (CHEBI:88046) |
| IUPAC Name |
|---|
| (2aS,3R,4S,5aS,7R)-7-[(R)-(2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)(hydroxy)methyl]-3-methyl-2a,3,4,5,5a,6,7,8-octahydro-2H-1,8,8b-triazaacenaphthylen-4-yl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| CYL | ChEBI |
| (−)-cylindrospermopsin | ChEBI |
| CYN | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C19999 | KEGG COMPOUND |
| Cylindrospermopsin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:143545-90-8 | ChemIDplus |
| Citations |
|---|