EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N5O7S |
| Net Charge | 0 |
| Average Mass | 415.428 |
| Monoisotopic Mass | 415.11617 |
| SMILES | [H][C@@]12C[C@H](OS(=O)(=O)O)[C@H](C)[C@@]3([H])CN=C(N[C@@]([H])([C@@H](O)c4cc(=O)nc(=O)n4)C1)N23 |
| InChI | InChI=1S/C15H21N5O7S/c1-6-10-5-16-14-17-8(13(22)9-4-12(21)19-15(23)18-9)2-7(20(10)14)3-11(6)27-28(24,25)26/h4,6-8,10-11,13,22H,2-3,5H2,1H3,(H,16,17)(H,24,25,26)(H2,18,19,21,23)/t6-,7+,8-,10-,11+,13-/m1/s1 |
| InChIKey | LHJPHMKIGRLKDR-VDPNAHCISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cylindrospermopsis raciborskii (ncbitaxon:77022) | - | PubMed (14559084) | |
| Oscillatoria sp. (ncbitaxon:1159) | - | PubMed (20525864) | Strain: PCC 6506 |
| Aphanizomenon ovalisporum (ncbitaxon:75695) | - | PubMed (10757726) |
| Roles Classification |
|---|
| Biological Roles: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. cyanotoxin Any toxin produced by cyanobacteria (blue-green algae). protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cylindrospermopsin (CHEBI:88046) has role cyanotoxin (CHEBI:88048) |
| cylindrospermopsin (CHEBI:88046) has role genotoxin (CHEBI:50902) |
| cylindrospermopsin (CHEBI:88046) has role hepatotoxic agent (CHEBI:50908) |
| cylindrospermopsin (CHEBI:88046) has role protein synthesis inhibitor (CHEBI:48001) |
| cylindrospermopsin (CHEBI:88046) is a alkaloid (CHEBI:22315) |
| cylindrospermopsin (CHEBI:88046) is a cylindrospermopsins (CHEBI:88045) |
| cylindrospermopsin (CHEBI:88046) is a organic sulfate (CHEBI:25704) |
| cylindrospermopsin (CHEBI:88046) is a pyrimidone (CHEBI:38337) |
| cylindrospermopsin (CHEBI:88046) is a secondary alcohol (CHEBI:35681) |
| cylindrospermopsin (CHEBI:88046) is a triazaacenaphthylene (CHEBI:88047) |
| cylindrospermopsin (CHEBI:88046) is tautomer of cylindrospermopsin zwitterion (CHEBI:88044) |
| Incoming Relation(s) |
| cylindrospermopsin zwitterion (CHEBI:88044) is tautomer of cylindrospermopsin (CHEBI:88046) |
| IUPAC Name |
|---|
| (2aS,3R,4S,5aS,7R)-7-[(R)-(2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)(hydroxy)methyl]-3-methyl-2a,3,4,5,5a,6,7,8-octahydro-2H-1,8,8b-triazaacenaphthylen-4-yl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| (−)-cylindrospermopsin | ChEBI |
| CYN | ChEBI |
| CYL | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Cylindrospermopsin | Wikipedia |
| C19999 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:143545-90-8 | ChemIDplus |
| Citations |
|---|