EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (CH2)l.(CH2)m.(CH2)n.(CH2)p.(CH2)q.C13H19O4 |
| Net Charge | -1 |
| Average Mass | 309.426 |
| Monoisotopic Mass | 309.20713 |
| SMILES | CC[C@H](C)C(=O)CC1CC1C/C=C\C[C@@H](O)[C@@H](CC)C(=O)[O-] |
| InChI | InChI=1S/C18H30O4/c1-4-12(3)17(20)11-14-10-13(14)8-6-7-9-16(19)15(5-2)18(21)22/h6-7,12-16,19H,4-5,8-11H2,1-3H3,(H,21,22)/p-1/b7-6-/t12-,13?,14?,15+,16+/m0/s1 |
| InChIKey | PPGCTBHMJARNCR-HNAYBLEOSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ketomycolate type-3 (XIII') (CHEBI:88039) is a branched-chain fatty acid anion (CHEBI:58955) |
| ketomycolate type-3 (XIII') (CHEBI:88039) is a mycolate (CHEBI:25436) |
| ketomycolate type-3 (XIII') (CHEBI:88039) is a oxo fatty acid anion (CHEBI:59836) |
| ketomycolate type-3 (XIII') (CHEBI:88039) is conjugate base of ketomycolic acid type-3 (XIII') (CHEBI:141096) |
| Incoming Relation(s) |
| ketomycolic acid type-3 (XIII') (CHEBI:141096) is conjugate acid of ketomycolate type-3 (XIII') (CHEBI:88039) |
| UniProt Name | Source |
|---|---|
| (Z)-Δ-(Z)-cyclopropyl-oxomycolate | UniProt |
| Citations |
|---|