EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H50N4O6S |
| Net Charge | 0 |
| Average Mass | 630.852 |
| Monoisotopic Mass | 630.34511 |
| SMILES | CC(C)(C)S(=O)(=O)C[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1cncn1)C(=O)N[C@@H](CC1CCCCC1)[C@@H](O)[C@@H](O)C1CC1 |
| InChI | InChI=1S/C33H50N4O6S/c1-33(2,3)44(42,43)20-25(16-22-10-6-4-7-11-22)31(40)37-28(18-26-19-34-21-35-26)32(41)36-27(17-23-12-8-5-9-13-23)30(39)29(38)24-14-15-24/h4,6-7,10-11,19,21,23-25,27-30,38-39H,5,8-9,12-18,20H2,1-3H3,(H,34,35)(H,36,41)(H,37,40)/t25-,27+,28+,29+,30-/m1/s1 |
| InChIKey | UXIGZRQVLGFTOU-VQXQMPIVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | peptidomimetic A small protein-like chain designed to mimic a peptide. EC 3.4.23.15 (renin) inhibitor An EC 3.4.23.* (aspartic endopeptidase) inhibitor that interferes with the activity of renin (EC 3.4.23.15). |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| remikiren (CHEBI:8803) has role antihypertensive agent (CHEBI:35674) |
| remikiren (CHEBI:8803) has role cardiovascular drug (CHEBI:35554) |
| remikiren (CHEBI:8803) has role EC 3.4.23.15 (renin) inhibitor (CHEBI:166822) |
| remikiren (CHEBI:8803) has role peptidomimetic (CHEBI:63175) |
| remikiren (CHEBI:8803) has role vasodilator agent (CHEBI:35620) |
| remikiren (CHEBI:8803) is a L-histidine derivative (CHEBI:84076) |
| remikiren (CHEBI:8803) is a cyclopropanes (CHEBI:51454) |
| remikiren (CHEBI:8803) is a diol (CHEBI:23824) |
| remikiren (CHEBI:8803) is a secondary carboxamide (CHEBI:140325) |
| remikiren (CHEBI:8803) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| Nα-[(2S)-2-benzyl-3-(tert-butylsulfonyl)propanoyl]-N-[(2S,3R,4S)-1-cyclohexyl-4-cyclopropyl-3,4-dihydroxybutan-2-yl]-L-histidinamide |
| INNs | Source |
|---|---|
| remikiren | WHO MedNet |
| rémikirène | WHO MedNet |
| remikireno | WHO MedNet |
| remikirenum | WHO MedNet |
| Synonyms | Source |
|---|---|
| N-[(2S,3R,4S)-1-cyclohexyl-4-cyclopropyl-3,4-dihydroxybutan-2-yl]-Nalpha-{(2S)-2-[(2-methylpropane-2-sulfonyl)methyl]-3-phenylpropanoyl}-L-histidinamide | IUPAC |
| Ro 42-5892 | KEGG COMPOUND |
| Ro-42-5892 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:126222-34-2 | ChemIDplus |
| Citations |
|---|