EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H50N4O6S |
| Net Charge | 0 |
| Average Mass | 630.852 |
| Monoisotopic Mass | 630.34511 |
| SMILES | CC(C)(C)S(=O)(=O)C[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1cncn1)C(=O)N[C@@H](CC1CCCCC1)[C@@H](O)[C@@H](O)C1CC1 |
| InChI | InChI=1S/C33H50N4O6S/c1-33(2,3)44(42,43)20-25(16-22-10-6-4-7-11-22)31(40)37-28(18-26-19-34-21-35-26)32(41)36-27(17-23-12-8-5-9-13-23)30(39)29(38)24-14-15-24/h4,6-7,10-11,19,21,23-25,27-30,38-39H,5,8-9,12-18,20H2,1-3H3,(H,34,35)(H,36,41)(H,37,40)/t25-,27+,28+,29+,30-/m1/s1 |
| InChIKey | UXIGZRQVLGFTOU-VQXQMPIVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.23.15 (renin) inhibitor An EC 3.4.23.* (aspartic endopeptidase) inhibitor that interferes with the activity of renin (EC 3.4.23.15). peptidomimetic A small protein-like chain designed to mimic a peptide. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| remikiren (CHEBI:8803) has role antihypertensive agent (CHEBI:35674) |
| remikiren (CHEBI:8803) has role EC 3.4.23.15 (renin) inhibitor (CHEBI:166822) |
| remikiren (CHEBI:8803) has role peptidomimetic (CHEBI:63175) |
| remikiren (CHEBI:8803) has role vasodilator agent (CHEBI:35620) |
| remikiren (CHEBI:8803) is a L-histidine derivative (CHEBI:84076) |
| remikiren (CHEBI:8803) is a cyclopropanes (CHEBI:51454) |
| remikiren (CHEBI:8803) is a diol (CHEBI:23824) |
| remikiren (CHEBI:8803) is a secondary carboxamide (CHEBI:140325) |
| remikiren (CHEBI:8803) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| Nα-[(2S)-2-benzyl-3-(tert-butylsulfonyl)propanoyl]-N-[(2S,3R,4S)-1-cyclohexyl-4-cyclopropyl-3,4-dihydroxybutan-2-yl]-L-histidinamide |
| INNs | Source |
|---|---|
| remikiren | WHO MedNet |
| rémikirène | WHO MedNet |
| remikireno | WHO MedNet |
| remikirenum | WHO MedNet |
| Synonyms | Source |
|---|---|
| N-[(2S,3R,4S)-1-cyclohexyl-4-cyclopropyl-3,4-dihydroxybutan-2-yl]-Nalpha-{(2S)-2-[(2-methylpropane-2-sulfonyl)methyl]-3-phenylpropanoyl}-L-histidinamide | IUPAC |
| Ro 42-5892 | KEGG COMPOUND |
| Ro-42-5892 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:126222-34-2 | ChemIDplus |
| Citations |
|---|