EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42N3 |
| Net Charge | +1 |
| Average Mass | 456.698 |
| Monoisotopic Mass | 456.33732 |
| SMILES | CCN(CC)c1ccc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C31H42N3/c1-7-32(8-2)28-19-13-25(14-20-28)31(26-15-21-29(22-16-26)33(9-3)10-4)27-17-23-30(24-18-27)34(11-5)12-6/h13-24H,7-12H2,1-6H3/q+1 |
| InChIKey | VYYRJGKHDDYUGK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl violet cation (CHEBI:88012) has role fluorochrome (CHEBI:51217) |
| ethyl violet cation (CHEBI:88012) has role histological dye (CHEBI:77178) |
| ethyl violet cation (CHEBI:88012) is a iminium ion (CHEBI:35286) |
| Incoming Relation(s) |
| ethyl violet (CHEBI:88010) has part ethyl violet cation (CHEBI:88012) |
| IUPAC Name |
|---|
| 4-{bis[4-(diethylamino)phenyl]methylidene}-N,N-diethylcyclohexa-2,5-dien-1-iminium |
| Synonyms | Source |
|---|---|
| ethyl violet(1+) | ChEBI |
| ethyl violet carbocation | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3915490 | Reaxys |