EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO3 |
| Net Charge | 0 |
| Average Mass | 143.142 |
| Monoisotopic Mass | 143.05824 |
| SMILES | O=C1CCCC(C(=O)O)N1 |
| InChI | InChI=1S/C6H9NO3/c8-5-3-1-2-4(7-5)6(9)10/h4H,1-3H2,(H,7,8)(H,9,10) |
| InChIKey | FZXCPFJMYOQZCA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS219) | |
| Penicillium chrysogenum (ncbitaxon:5076) | - | PubMed (1367520) | Strain: PQ-96 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-ketopiperidine-2-carboxylic acid (CHEBI:87998) has role bacterial metabolite (CHEBI:76969) |
| 6-ketopiperidine-2-carboxylic acid (CHEBI:87998) is a monocarboxylic acid (CHEBI:25384) |
| 6-ketopiperidine-2-carboxylic acid (CHEBI:87998) is a δ-lactam (CHEBI:77727) |
| 6-ketopiperidine-2-carboxylic acid (CHEBI:87998) is conjugate acid of 6-ketopiperidine-2-carboxylate (CHEBI:133178) |
| Incoming Relation(s) |
| 6-ketopiperidine-2-carboxylate (CHEBI:133178) is conjugate base of 6-ketopiperidine-2-carboxylic acid (CHEBI:87998) |
| IUPAC Name |
|---|
| 6-oxopiperidine-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| adipo-2,6-lactam | ChEBI |
| cyclic α-aminoadipic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:82377 | Reaxys |
| CAS:3770-22-7 | ChemIDplus |
| Citations |
|---|