EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5[13C]H14O6 |
| Net Charge | 0 |
| Average Mass | 183.164 |
| Monoisotopic Mass | 183.08239 |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[13CH2]O |
| WURCS | WURCS=2.0/1,1,0/[h2122h]/1/ |
| InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6-/m1/s1/i1+1/t3-,4+,5+,6+/m0 |
| InChIKey | FBPFZTCFMRRESA-AVUGZHLXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | MetaboLights (MTBLS171) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-(1-13C)glucitol (CHEBI:87978) is a 13C-modified compound (CHEBI:139357) |
| D-(1-13C)glucitol (CHEBI:87978) is a glucitol (CHEBI:30911) |
| IUPAC Name |
|---|
| D-(1-13C)glucitol |
| Synonyms | Source |
|---|---|
| (13C)sorbitol | ChEBI |
| D-(1-13C)sorbitol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4291813 | Reaxys |