EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | [13C5]H11O2 |
| Net Charge | 0 |
| Average Mass | 123.103 |
| Monoisotopic Mass | 123.09279 |
| SMILES | [13CH3][13CH]([13CH3])[13C@H]([15NH2])[13C](=O)O |
| InChI | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | KZSNJWFQEVHDMF-XAFSXMPTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | MetaboLights (MTBLS171) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (13C5,15N)-valine (CHEBI:87977) is a 13C-modified compound (CHEBI:139357) |
| (13C5,15N)-valine (CHEBI:87977) is a 15N-modified compound (CHEBI:139360) |
| (13C5,15N)-valine (CHEBI:87977) is a L-α-amino acid (CHEBI:15705) |
| (13C5,15N)-valine (CHEBI:87977) is a valine (CHEBI:27266) |
| IUPAC Name |
|---|
| L-(13C5,15N)valine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8056344 | Reaxys |