EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (CH2)k.(CH2)l.(CH2)m.(CH2)n.C11H18O3 |
| Net Charge | 0 |
| Average Mass | 254.370 |
| Monoisotopic Mass | 254.18819 |
| SMILES | CCC1CC1CC1CC1C[C@@H](O)[C@@H](CC)C(=O)O |
| InChI | InChI=1S/C15H26O3/c1-3-9-5-10(9)6-11-7-12(11)8-14(16)13(4-2)15(17)18/h9-14,16H,3-8H2,1-2H3,(H,17,18)/t9?,10?,11?,12?,13-,14-/m1/s1 |
| InChIKey | QRLPHSLZHKIQHB-NCXJMQDXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| an α-mycolic acid (CHEBI:87902) is a mycolic acid (CHEBI:25438) |
| an α-mycolic acid (CHEBI:87902) is a organic molecular entity (CHEBI:50860) |
| an α-mycolic acid (CHEBI:87902) is conjugate acid of an α-mycolate (CHEBI:87903) |
| Incoming Relation(s) |
| (2R)-2-[(1R)-1-hydroxy-18-{2-[10-(2-nonadecylcyclopropyl)decyl]cyclopropyl}octadecyl]hexacosanoate (CHEBI:87979) is a an α-mycolic acid (CHEBI:87902) |
| an α-mycolate (CHEBI:87903) is conjugate base of an α-mycolic acid (CHEBI:87902) |
| Citations |
|---|