EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30O5 |
| Net Charge | 0 |
| Average Mass | 386.488 |
| Monoisotopic Mass | 386.20932 |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@@H](O)CC(=O)[C@@H]1/C=C/[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C23H30O5/c24-18(13-12-17-8-4-3-5-9-17)14-15-20-19(21(25)16-22(20)26)10-6-1-2-7-11-23(27)28/h1,3-6,8-9,14-15,18-21,24-25H,2,7,10-13,16H2,(H,27,28)/b6-1-,15-14+/t18-,19+,20+,21-/m0/s1 |
| InChIKey | OAQGPAZDRCBBLD-YTCWWFNZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS124) | ||
| - | MetaboLights (MTBLS93) | ||
| - | PubMed (25502724) | ||
| - | MetaboLights (MTBLS90) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-phenyl-18,19,20-trinor-prostaglandin D2 (CHEBI:87821) has role human metabolite (CHEBI:77746) |
| 17-phenyl-18,19,20-trinor-prostaglandin D2 (CHEBI:87821) is a alicyclic ketone (CHEBI:36132) |
| 17-phenyl-18,19,20-trinor-prostaglandin D2 (CHEBI:87821) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 17-phenyl-18,19,20-trinor-prostaglandin D2 (CHEBI:87821) is a olefinic compound (CHEBI:78840) |
| 17-phenyl-18,19,20-trinor-prostaglandin D2 (CHEBI:87821) is a oxo monocarboxylic acid (CHEBI:35871) |
| 17-phenyl-18,19,20-trinor-prostaglandin D2 (CHEBI:87821) is a prostanoid (CHEBI:26347) |
| 17-phenyl-18,19,20-trinor-prostaglandin D2 (CHEBI:87821) is a secondary alcohol (CHEBI:35681) |
| 17-phenyl-18,19,20-trinor-prostaglandin D2 (CHEBI:87821) is a β-hydroxy ketone (CHEBI:55380) |
| IUPAC Name |
|---|
| (5Z)-7-{(1R,2R,5S)-5-hydroxy-2-[(1E,3S)-3-hydroxy-5-phenylpent-1-en-1-yl]-3-oxocyclopentyl}hept-5-enoic acid |
| Synonyms | Source |
|---|---|
| 17-phenyltrinor-prostaglandin D2 | ChEBI |
| 17-phenyl-ω-trinor-prostaglandin D2 | ChEBI |
| 17-phenyltrinor-PGD2 | ChEBI |
| 17-phenyl-18,19,20-trinor-PGD2 | ChEBI |
| 17-phenyl-ω-trinor-PGD2 | ChEBI |
| 7-(5-Hydroxy-2-(3-hydroxy-5-phenyl-1-octenyl)-3-oxocyclopentyl)-5-heptenoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6000594 | Reaxys |
| CAS:85280-91-7 | ChemIDplus |