EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O |
| Net Charge | 0 |
| Average Mass | 128.215 |
| Monoisotopic Mass | 128.12012 |
| SMILES | CCCCC(C=O)CC |
| InChI | InChI=1S/C8H16O/c1-3-5-6-8(4-2)7-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | LGYNIFWIKSEESD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethylhexanal (CHEBI:87809) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 2-ethylhexanal (CHEBI:87809) has role fungal metabolite (CHEBI:76946) |
| 2-ethylhexanal (CHEBI:87809) is a saturated fatty aldehyde (CHEBI:133249) |
| IUPAC Name |
|---|
| 2-ethylhexanal |
| Synonyms | Source |
|---|---|
| 2-ethylcaproaldehyde | ChemIDplus |
| 2-ethylhexaldehyde | ChemIDplus |
| 2-ethylhexan-1-al | NIST Chemistry WebBook |
| 2-ethylhexylaldehyde | ChemIDplus |
| 3-formylheptane | NIST Chemistry WebBook |
| butyl ethyl acetaldehyde | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-ethylhexanal | UniProt |
| Citations |
|---|