EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O3 |
| Net Charge | 0 |
| Average Mass | 230.263 |
| Monoisotopic Mass | 230.09429 |
| SMILES | Oc1cccc(CCc2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C14H14O3/c15-12-3-1-2-10(6-12)4-5-11-7-13(16)9-14(17)8-11/h1-3,6-9,15-17H,4-5H2 |
| InChIKey | UMZJVKFVOMTAFO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phalaenopsis sp. (ncbitaxon:36900) | - | PubMed (7872785) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3',5-trihydroxybibenzyl (CHEBI:87804) has parent hydride 1,2-dihydrostilbene (CHEBI:34047) |
| 3,3',5-trihydroxybibenzyl (CHEBI:87804) has role plant metabolite (CHEBI:76924) |
| 3,3',5-trihydroxybibenzyl (CHEBI:87804) is a diphenylethane (CHEBI:51571) |
| 3,3',5-trihydroxybibenzyl (CHEBI:87804) is a polyphenol (CHEBI:26195) |
| 3,3',5-trihydroxybibenzyl (CHEBI:87804) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 5-[2-(3-hydroxyphenyl)ethyl]benzene-1,3-diol |
| UniProt Name | Source |
|---|---|
| 3,3',5-trihydroxybibenzyl | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8209733 | Reaxys |
| CAS:58436-28-5 | ChemIDplus |
| Citations |
|---|