EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O4 |
| Net Charge | 0 |
| Average Mass | 430.629 |
| Monoisotopic Mass | 430.30831 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC[C@@H](C)C(=O)O)[C@]1([H])C(=O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C27H42O4/c1-16(6-5-7-17(2)25(30)31)20-8-9-21-24-22(11-13-27(20,21)4)26(3)12-10-19(28)14-18(26)15-23(24)29/h15-17,19-22,24,28H,5-14H2,1-4H3,(H,30,31)/t16-,17-,19+,20-,21+,22+,24+,26+,27-/m1/s1 |
| InChIKey | QOEPZHFZXUROGV-BXDHRDAUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21411718) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (25R)-3β-hydroxycholest-5-en-7-one-26-oic acid (CHEBI:87783) has functional parent cholesterol (CHEBI:16113) |
| (25R)-3β-hydroxycholest-5-en-7-one-26-oic acid (CHEBI:87783) has role human xenobiotic metabolite (CHEBI:76967) |
| (25R)-3β-hydroxycholest-5-en-7-one-26-oic acid (CHEBI:87783) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| (25R)-3β-hydroxycholest-5-en-7-one-26-oic acid (CHEBI:87783) is a 3β-sterol (CHEBI:35348) |
| (25R)-3β-hydroxycholest-5-en-7-one-26-oic acid (CHEBI:87783) is a 7-oxo steroid (CHEBI:47789) |
| (25R)-3β-hydroxycholest-5-en-7-one-26-oic acid (CHEBI:87783) is a cholestanoid (CHEBI:50401) |
| (25R)-3β-hydroxycholest-5-en-7-one-26-oic acid (CHEBI:87783) is a monocarboxylic acid (CHEBI:25384) |
| (25R)-3β-hydroxycholest-5-en-7-one-26-oic acid (CHEBI:87783) is a oxysterol (CHEBI:53030) |
| (25R)-3β-hydroxycholest-5-en-7-one-26-oic acid (CHEBI:87783) is a steroid acid (CHEBI:47891) |
| (25R)-3β-hydroxycholest-5-en-7-one-26-oic acid (CHEBI:87783) is conjugate acid of (25R)-3β-hydroxycholest-5-en-7-one-26-oate (CHEBI:87678) |
| Incoming Relation(s) |
| (25R)-3β-hydroxycholest-5-en-7-one-26-oate (CHEBI:87678) is conjugate base of (25R)-3β-hydroxycholest-5-en-7-one-26-oic acid (CHEBI:87783) |
| IUPAC Name |
|---|
| (25R)-3β-hydroxycholest-5-en-7-one-26-oic acid |
| Synonym | Source |
|---|---|
| (3β,25R)-3-hydroxy-7-oxocholest-5-en-26-oic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22179398 | Reaxys |
| Citations |
|---|