EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO4 |
| Net Charge | 0 |
| Average Mass | 327.380 |
| Monoisotopic Mass | 327.14706 |
| SMILES | CC(C)COC(=O)c1cccc(C(=O)OCCc2ccccc2)n1 |
| InChI | InChI=1S/C19H21NO4/c1-14(2)13-24-19(22)17-10-6-9-16(20-17)18(21)23-12-11-15-7-4-3-5-8-15/h3-10,14H,11-13H2,1-2H3 |
| InChIKey | TZKVLZPGKZHHNX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isobutyl 2-phenylethyl 2,6-pyridinedicarboxylate (CHEBI:87776) has role metabolite (CHEBI:25212) |
| isobutyl 2-phenylethyl 2,6-pyridinedicarboxylate (CHEBI:87776) is a dicarboxylic acids and O-substituted derivatives (CHEBI:131927) |
| isobutyl 2-phenylethyl 2,6-pyridinedicarboxylate (CHEBI:87776) is a diester (CHEBI:51307) |
| isobutyl 2-phenylethyl 2,6-pyridinedicarboxylate (CHEBI:87776) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 2-methylpropyl 2-phenylethyl pyridine-2,6-dicarboxylate |