EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O5 |
| Net Charge | 0 |
| Average Mass | 172.136 |
| Monoisotopic Mass | 172.03717 |
| SMILES | O=C(O)C/C=C\CC(=O)C(=O)O |
| InChI | InChI=1S/C7H8O5/c8-5(7(11)12)3-1-2-4-6(9)10/h1-2H,3-4H2,(H,9,10)(H,11,12)/b2-1- |
| InChIKey | ICGKEQXHPZUYSF-UPHRSURJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4Z)-2-oxohept-4-enedioic acid (CHEBI:87772) is a dicarboxylic fatty acid (CHEBI:189840) |
| (4Z)-2-oxohept-4-enedioic acid (CHEBI:87772) is a olefinic compound (CHEBI:78840) |
| (4Z)-2-oxohept-4-enedioic acid (CHEBI:87772) is a oxo dicarboxylic acid (CHEBI:36145) |
| (4Z)-2-oxohept-4-enedioic acid (CHEBI:87772) is conjugate acid of (4Z)-2-oxohept-4-enedioate (CHEBI:87507) |
| (4Z)-2-oxohept-4-enedioic acid (CHEBI:87772) is tautomer of (2Z,4Z)-2-hydroxyhepta-2,4-dienedioic acid (CHEBI:87771) |
| Incoming Relation(s) |
| (4Z)-2-oxohept-4-enedioate (CHEBI:87507) is conjugate base of (4Z)-2-oxohept-4-enedioic acid (CHEBI:87772) |
| (2Z,4Z)-2-hydroxyhepta-2,4-dienedioic acid (CHEBI:87771) is tautomer of (4Z)-2-oxohept-4-enedioic acid (CHEBI:87772) |
| IUPAC Name |
|---|
| (3Z)-6-oxohept-3-enedioic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8201887 | Reaxys |