EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C13H22N4O3S.Cl |
| Net Charge | 0 |
| Average Mass | 350.872 |
| Monoisotopic Mass | 350.11794 |
| SMILES | CN/C(=C\[N+](=O)[O-])NCCSCc1ccc(CN(C)C)o1.[Cl-].[H+] |
| InChI | InChI=1S/C13H22N4O3S.ClH/c1-14-13(9-17(18)19)15-6-7-21-10-12-5-4-11(20-12)8-16(2)3;/h4-5,9,14-15H,6-8,10H2,1-3H3;1H/b13-9+; |
| InChIKey | GGWBHVILAJZWKJ-KJEVSKRMSA-N |
| Roles Classification |
|---|
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ranitidine hydrochloride (CHEBI:8777) has part ranitidine (CHEBI:8776) |
| ranitidine hydrochloride (CHEBI:8777) has role drug allergen (CHEBI:88188) |
| ranitidine hydrochloride (CHEBI:8777) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (E)-N-{2-[({5-[(dimethylamino)methyl]-2-furyl}methyl)sulfanyl]ethyl}-N'-methyl-2-nitroethene-1,1-diamine hydrochloride |
| Synonym | Source |
|---|---|
| Ranitidine HCL | ChemIDplus |
| Brand Names | Source |
|---|---|
| Alquen | DrugBank |
| Coralen | DrugBank |
| Fendibina | DrugBank |
| Gastrial | DrugBank |
| Gastridina | DrugBank |
| Gastrolav | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:66357-59-3 | ChemIDplus |