EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H55NO3 |
| Net Charge | 0 |
| Average Mass | 453.752 |
| Monoisotopic Mass | 453.41819 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C28H55NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-27(30)29-26-28(31)32/h2-26H2,1H3,(H,29,30)(H,31,32) |
| InChIKey | YIUHXZHKDQGNOC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (12810727) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hexacosanoylglycine (CHEBI:87768) has functional parent hexacosanoic acid (CHEBI:31009) |
| N-hexacosanoylglycine (CHEBI:87768) has role human blood serum metabolite (CHEBI:85234) |
| N-hexacosanoylglycine (CHEBI:87768) has role human urinary metabolite (CHEBI:84087) |
| N-hexacosanoylglycine (CHEBI:87768) is a N-acylglycine (CHEBI:16180) |
| N-hexacosanoylglycine (CHEBI:87768) is a fatty amide (CHEBI:29348) |
| N-hexacosanoylglycine (CHEBI:87768) is conjugate acid of N-hexacosanoylglycinate (CHEBI:87414) |
| Incoming Relation(s) |
| N-hexacosanoylglycinate (CHEBI:87414) is conjugate base of N-hexacosanoylglycine (CHEBI:87768) |
| IUPAC Name |
|---|
| N-hexacosanoylglycine |
| Synonyms | Source |
|---|---|
| 2-hexacosanamidoacetic acid | ChEBI |
| N-cerotoylglycine | ChEBI |
| hexacosanamidoacetic acid | ChEBI |
| hexacosanoylglycine | ChEBI |
| Citations |
|---|