EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H10O2 |
| Net Charge | 0 |
| Average Mass | 282.298 |
| Monoisotopic Mass | 282.06808 |
| SMILES | O=c1ccc2c(cc3ccc4cccc5ccc2c3c45)c1=O |
| InChI | InChI=1S/C20H10O2/c21-17-9-8-14-15-7-6-12-3-1-2-11-4-5-13(19(15)18(11)12)10-16(14)20(17)22/h1-10H |
| InChIKey | CRYMJHJFLJAFNU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzo[a]pyrene-7,8-dione (CHEBI:87752) has functional parent benzo[a]pyrene-cis-7,8-dihydrodiol (CHEBI:81626) |
| benzo[a]pyrene-7,8-dione (CHEBI:87752) has parent hydride benzo[a]pyrene (CHEBI:29865) |
| benzo[a]pyrene-7,8-dione (CHEBI:87752) has role genotoxin (CHEBI:50902) |
| benzo[a]pyrene-7,8-dione (CHEBI:87752) has role xenobiotic metabolite (CHEBI:76206) |
| benzo[a]pyrene-7,8-dione (CHEBI:87752) is a orthoquinones (CHEBI:25622) |
| benzo[a]pyrene-7,8-dione (CHEBI:87752) is a pyrenes (CHEBI:59659) |
| IUPAC Name |
|---|
| benzo[pqr]tetraphene-7,8-dione |
| Synonyms | Source |
|---|---|
| BaP-7,8-dione | ChEBI |
| benzo(a)pyrene-7,8-dione | ChemIDplus |
| benzo(a)pyrene-7,8-quinone | ChemIDplus |
| benzo[a]pyrene-7,8-quinone | ChEBI |
| BPQ | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3551534 | Reaxys |
| CAS:65199-11-3 | ChemIDplus |
| Citations |
|---|