EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15O4 |
| Net Charge | -1 |
| Average Mass | 307.325 |
| Monoisotopic Mass | 307.09758 |
| SMILES | CC(=O)C[C@H](c1ccccc1)c1c([O-])c2ccccc2oc1=O |
| InChI | InChI=1S/C19H16O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,15,21H,11H2,1H3/p-1/t15-/m1/s1 |
| InChIKey | PJVWKTKQMONHTI-OAHLLOKOSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-warfarin(1−) (CHEBI:87743) is a organic anion (CHEBI:25696) |
| (R)-warfarin(1−) (CHEBI:87743) is conjugate base of (R)-warfarin (CHEBI:87737) |
| (R)-warfarin(1−) (CHEBI:87743) is enantiomer of (S)-warfarin(1−) (CHEBI:87744) |
| Incoming Relation(s) |
| (R)-warfarin potassium (CHEBI:87741) has part (R)-warfarin(1−) (CHEBI:87743) |
| (R)-warfarin sodium (CHEBI:87739) has part (R)-warfarin(1−) (CHEBI:87743) |
| warfarin(1−) (CHEBI:50393) has part (R)-warfarin(1−) (CHEBI:87743) |
| (R)-warfarin (CHEBI:87737) is conjugate acid of (R)-warfarin(1−) (CHEBI:87743) |
| (S)-warfarin(1−) (CHEBI:87744) is enantiomer of (R)-warfarin(1−) (CHEBI:87743) |
| IUPAC Name |
|---|
| 2-oxo-3-[(1R)-3-oxo-1-phenylbutyl]-2H-1-benzopyran-4-olate |