EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32N2O5 |
| Net Charge | 0 |
| Average Mass | 416.518 |
| Monoisotopic Mass | 416.23112 |
| SMILES | [H][C@@]12CCC[C@]1([H])N(C(=O)[C@H](C)N[C@@H](CCc1ccccc1)C(=O)OCC)[C@H](C(=O)O)C2 |
| InChI | InChI=1S/C23H32N2O5/c1-3-30-23(29)18(13-12-16-8-5-4-6-9-16)24-15(2)21(26)25-19-11-7-10-17(19)14-20(25)22(27)28/h4-6,8-9,15,17-20,24H,3,7,10-14H2,1-2H3,(H,27,28)/t15-,17-,18-,19-,20-/m0/s1 |
| InChIKey | HDACQVRGBOVJII-JBDAPHQKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bradykinin receptor B2 agonist A bradykinin agonist that binds to and activates bradykinin B2 receptors. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. cardioprotective agent Any protective agent that is able to prevent damage to the heart. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ramipril (CHEBI:8774) has role bradykinin receptor B2 agonist (CHEBI:77496) |
| ramipril (CHEBI:8774) has role cardioprotective agent (CHEBI:77307) |
| ramipril (CHEBI:8774) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| ramipril (CHEBI:8774) has role matrix metalloproteinase inhibitor (CHEBI:50664) |
| ramipril (CHEBI:8774) has role prodrug (CHEBI:50266) |
| ramipril (CHEBI:8774) is a azabicycloalkane (CHEBI:38295) |
| ramipril (CHEBI:8774) is a cyclopentapyrrole (CHEBI:38296) |
| ramipril (CHEBI:8774) is a dicarboxylic acid monoester (CHEBI:36244) |
| ramipril (CHEBI:8774) is a dipeptide (CHEBI:46761) |
| ramipril (CHEBI:8774) is a ethyl ester (CHEBI:23990) |
| ramipril (CHEBI:8774) is conjugate acid of ramipril(1−) (CHEBI:231704) |
| Incoming Relation(s) |
| ramipril(1−) (CHEBI:231704) is conjugate base of ramipril (CHEBI:8774) |
| IUPAC Name |
|---|
| (2S,3aS,6aS)-1-[(2S)-2-{[(1S)-1-ethoxycarbonyl-3-phenylpropyl]amino}propanoyl]octahydrocyclopenta[b]pyrrole-2-carboxylic acid |
| INN | Source |
|---|---|
| ramipril | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S-(1(R*(R*)),2alpha,3abeta,6abeta))-1-(2-((1-(Ethoxycarbonyl)-3-phenylpropyl)amino)-1-oxopropyl)octahydrocyclopenta(b)pyrrole-2-carboxylic acid | ChemIDplus |
| Altace (TN) | KEGG DRUG |
| Ramipril | KEGG DRUG |
| Ramiprilum | DrugBank |
| Tritace | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4214464 | Reaxys |
| CAS:87333-19-5 | KEGG DRUG |
| CAS:87333-19-5 | ChemIDplus |
| Citations |
|---|