EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H39O5 |
| Net Charge | -1 |
| Average Mass | 407.571 |
| Monoisotopic Mass | 407.28030 |
| SMILES | [H][C@@]12C[C@@H](O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)[O-])[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C24H40O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-20,22,25-27H,4-12H2,1-3H3,(H,28,29)/p-1/t13-,14+,15+,16-,17+,18+,19-,20+,22+,23+,24-/m1/s1 |
| InChIKey | BHQCQFFYRZLCQQ-UXWVVXDJSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β,7α,12α-trihydroxy-5β-cholan-24-oate (CHEBI:87735) is a bile acid anion (CHEBI:36235) |
| 3β,7α,12α-trihydroxy-5β-cholan-24-oate (CHEBI:87735) is conjugate base of 3β,7α,12α-trihydroxy-5β-cholan-24-oic acid (CHEBI:88105) |
| Incoming Relation(s) |
| 3β,7α,12α-trihydroxy-5β-cholan-24-oic acid (CHEBI:88105) is conjugate acid of 3β,7α,12α-trihydroxy-5β-cholan-24-oate (CHEBI:87735) |
| IUPAC Name |
|---|
| 3β,7α,12α-trihydroxy-5β-cholan-24-oate |
| Synonym | Source |
|---|---|
| (3β,5β,7α,12α)-3,7,12-trihydroxycholan-24-oate | IUPAC |
| UniProt Name | Source |
|---|---|
| isocholate | UniProt |
| Citations |
|---|