EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H39O4 |
| Net Charge | -1 |
| Average Mass | 391.572 |
| Monoisotopic Mass | 391.28538 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(C[C@H](O)[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC(=O)[O-])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/p-1/t14-,15-,16+,17+,18-,19+,20+,21+,23+,24-/m1/s1 |
| InChIKey | KXGVEGMKQFWNSR-OFYXWCICSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β,12α-dihydroxy-5β-cholan-24-oate (CHEBI:87733) is a bile acid anion (CHEBI:36235) |
| 3β,12α-dihydroxy-5β-cholan-24-oate (CHEBI:87733) is conjugate base of 3β,12α-dihydroxy-5β-cholan-24-oic acid (CHEBI:88098) |
| Incoming Relation(s) |
| 3β,12α-dihydroxy-5β-cholan-24-oic acid (CHEBI:88098) is conjugate acid of 3β,12α-dihydroxy-5β-cholan-24-oate (CHEBI:87733) |
| IUPAC Name |
|---|
| 3β,12α-dihydroxy-5β-cholan-24-oate |
| UniProt Name | Source |
|---|---|
| isodeoxycholate | UniProt |
| Citations |
|---|