EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21FNO3S |
| Net Charge | +1 |
| Average Mass | 374.457 |
| Monoisotopic Mass | 374.12207 |
| SMILES | CC(=O)Oc1cc2c(s1)CC[NH+]([C@@H](C(=O)C1CC1)c1ccccc1F)C2 |
| InChI | InChI=1S/C20H20FNO3S/c1-12(23)25-18-10-14-11-22(9-8-17(14)26-18)19(20(24)13-6-7-13)15-4-2-3-5-16(15)21/h2-5,10,13,19H,6-9,11H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | DTGLZDAWLRGWQN-LJQANCHMSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-prasugrel(1+) (CHEBI:87727) is a ammonium ion derivative (CHEBI:35274) |
| (R)-prasugrel(1+) (CHEBI:87727) is a organic cation (CHEBI:25697) |
| (R)-prasugrel(1+) (CHEBI:87727) is conjugate acid of (R)-prasugrel (CHEBI:87725) |
| (R)-prasugrel(1+) (CHEBI:87727) is enantiomer of (S)-prasugrel(1+) (CHEBI:87726) |
| Incoming Relation(s) |
| (R)-prasugrel hydrochloride (CHEBI:87714) has part (R)-prasugrel(1+) (CHEBI:87727) |
| (R)-prasugrel (CHEBI:87725) is conjugate base of (R)-prasugrel(1+) (CHEBI:87727) |
| (S)-prasugrel(1+) (CHEBI:87726) is enantiomer of (R)-prasugrel(1+) (CHEBI:87727) |
| Synonym | Source |
|---|---|
| 2-(acetyloxy)-5-[(1R)-2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium | ChEBI |