EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22O |
| Net Charge | 0 |
| Average Mass | 194.318 |
| Monoisotopic Mass | 194.16707 |
| SMILES | [H][C@]12CC[C@H](C)O[C@@]1(C)C=CCC2(C)C |
| InChI | InChI=1S/C13H22O/c1-10-6-7-11-12(2,3)8-5-9-13(11,4)14-10/h5,9-11H,6-8H2,1-4H3/t10-,11+,13-/m0/s1 |
| InChIKey | IVTQSEFLDHBCDZ-LOWVWBTDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-dihydroedulan II (CHEBI:87716) has role metabolite (CHEBI:25212) |
| (−)-dihydroedulan II (CHEBI:87716) is a organic heterobicyclic compound (CHEBI:27171) |
| (−)-dihydroedulan II (CHEBI:87716) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| (2S,4aR,8aS)-2,5,5,8a-tetramethyl-3,4,4a,5,6,8a-hexahydro-2H-1-benzopyran |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4800259 | Reaxys |
| CAS:41678-32-4 | ChemIDplus |