EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20FNO3S.HCl |
| Net Charge | 0 |
| Average Mass | 409.910 |
| Monoisotopic Mass | 409.09147 |
| SMILES | CC(=O)Oc1cc2c(s1)CCN([C@H](C(=O)C1CC1)c1ccccc1F)C2.Cl |
| InChI | InChI=1S/C20H20FNO3S.ClH/c1-12(23)25-18-10-14-11-22(9-8-17(14)26-18)19(20(24)13-6-7-13)15-4-2-3-5-16(15)21;/h2-5,10,13,19H,6-9,11H2,1H3;1H/t19-;/m0./s1 |
| InChIKey | JALHGCPDPSNJNY-FYZYNONXSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-prasugrel hydrochloride (CHEBI:87708) has part (S)-prasugrel(1+) (CHEBI:87726) |
| (S)-prasugrel hydrochloride (CHEBI:87708) is a hydrochloride (CHEBI:36807) |
| (S)-prasugrel hydrochloride (CHEBI:87708) is enantiomer of (R)-prasugrel hydrochloride (CHEBI:87714) |
| Incoming Relation(s) |
| prasugrel hydrochloride (CHEBI:87697) has part (S)-prasugrel hydrochloride (CHEBI:87708) |
| (R)-prasugrel hydrochloride (CHEBI:87714) is enantiomer of (S)-prasugrel hydrochloride (CHEBI:87708) |
| IUPAC Names |
|---|
| 5-[(1S)-2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl acetate hydrochloride |
| 2-(acetyloxy)-5-[(1S)-2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium chloride |