EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N3O3S.Na |
| Net Charge | 0 |
| Average Mass | 381.433 |
| Monoisotopic Mass | 381.11231 |
| SMILES | COCCCOc1ccnc(CS(=O)c2nc3ccccc3[n-]2)c1C.[Na+] |
| InChI | InChI=1S/C18H20N3O3S.Na/c1-13-16(19-9-8-17(13)24-11-5-10-23-2)12-25(22)18-20-14-6-3-4-7-15(14)21-18;/h3-4,6-9H,5,10-12H2,1-2H3;/q-1;+1 |
| InChIKey | KRCQSTCYZUOBHN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rabeprazole sodium (CHEBI:8769) has part rabeprazole(1−) (CHEBI:49199) |
| rabeprazole sodium (CHEBI:8769) has role anti-ulcer drug (CHEBI:49201) |
| rabeprazole sodium (CHEBI:8769) has role antibacterial agent (CHEBI:33282) |
| rabeprazole sodium (CHEBI:8769) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 2-({[4-(3-methoxypropoxy)-3-methylpyridin-2-yl]methyl}sulfinyl)benzimidazol-1-ide |
| Synonyms | Source |
|---|---|
| Aciphex | KEGG DRUG |
| E-3810 | ChEMBL |
| E-3810 SODIUM | ChEMBL |
| Idiazole | ChEMBL |
| LY-307640 SODIUM | ChEMBL |
| LY307640 SODIUM | ChEMBL |
| Brand Names | Source |
|---|---|
| AcipHex | DrugBank |
| Aciphex sprinkle | ChEMBL |
| Pariet | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7561607 | Beilstein |
| CAS:117976-90-6 | ChemIDplus |
| CAS:117976-90-6 | KEGG COMPOUND |
| Citations |
|---|