EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O2 |
| Net Charge | 0 |
| Average Mass | 184.279 |
| Monoisotopic Mass | 184.14633 |
| SMILES | [H][C@]1(C(=O)O)CC[C@]([H])(C(C)(C)C)CC1 |
| InChI | InChI=1S/C11H20O2/c1-11(2,3)9-6-4-8(5-7-9)10(12)13/h8-9H,4-7H2,1-3H3,(H,12,13)/t8-,9- |
| InChIKey | QVQKEGYITJBHRQ-KYZUINATSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-4-tert-butylcyclohexanecarboxylic acid (CHEBI:87689) has parent hydride cyclohexane (CHEBI:29005) |
| trans-4-tert-butylcyclohexanecarboxylic acid (CHEBI:87689) has role metabolite (CHEBI:25212) |
| trans-4-tert-butylcyclohexanecarboxylic acid (CHEBI:87689) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| trans-4-tert-butylcyclohexane-1-carboxylic acid |
| Synonym | Source |
|---|---|
| trans-4-(dimethylethyl)cyclohexanecarboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2206821 | Reaxys |