EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O2 |
| Net Charge | 0 |
| Average Mass | 206.285 |
| Monoisotopic Mass | 206.13068 |
| SMILES | CCOC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C13H18O2/c1-5-15-12(14)10-6-8-11(9-7-10)13(2,3)4/h6-9H,5H2,1-4H3 |
| InChIKey | LIQWHXBLFOERRD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 4-tert-butylbenzoate (CHEBI:87686) has role metabolite (CHEBI:25212) |
| ethyl 4-tert-butylbenzoate (CHEBI:87686) is a benzoate ester (CHEBI:36054) |
| IUPAC Name |
|---|
| ethyl 4-tert-butylbenzoate |
| Synonyms | Source |
|---|---|
| 4-tert-butylbenzoic acid ethyl ester | ChEBI |
| ethyl 4-(1,1-dimethylethyl)benzoate | ChemIDplus |