EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18O2 |
| Net Charge | 0 |
| Average Mass | 158.241 |
| Monoisotopic Mass | 158.13068 |
| SMILES | CCCCCOC(=O)CCC |
| InChI | InChI=1S/C9H18O2/c1-3-5-6-8-11-9(10)7-4-2/h3-8H2,1-2H3 |
| InChIKey | CFNJLPHOBMVMNS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentyl butyrate (CHEBI:87684) has functional parent pentan-1-ol (CHEBI:44884) |
| pentyl butyrate (CHEBI:87684) has role metabolite (CHEBI:25212) |
| pentyl butyrate (CHEBI:87684) is a butyrate ester (CHEBI:50477) |
| IUPAC Name |
|---|
| pentyl butanoate |
| Synonyms | Source |
|---|---|
| Amyl butanoate | ChemIDplus |
| Amyl butyrate | ChemIDplus |
| n-Amyl butyrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034162 | HMDB |
| Citations |
|---|