EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N3O3S |
| Net Charge | 0 |
| Average Mass | 359.451 |
| Monoisotopic Mass | 359.13036 |
| SMILES | COCCCOc1ccnc(CS(=O)c2nc3ccccc3n2)c1C |
| InChI | InChI=1S/C18H21N3O3S/c1-13-16(19-9-8-17(13)24-11-5-10-23-2)12-25(22)18-20-14-6-3-4-7-15(14)21-18/h3-4,6-9H,5,10-12H2,1-2H3,(H,20,21) |
| InChIKey | YREYEVIYCVEVJK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that inhibits H+/K+-exchanging ATPase, EC 3.6.3.10. Such compounds are also known as proton pump inhibitors. |
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rabeprazole (CHEBI:8768) has role anti-ulcer drug (CHEBI:49201) |
| rabeprazole (CHEBI:8768) has role EC 3.6.3.10 (H+/K+-exchanging ATPase) inhibitor (CHEBI:49200) |
| rabeprazole (CHEBI:8768) is a benzimidazoles (CHEBI:22715) |
| rabeprazole (CHEBI:8768) is a pyridines (CHEBI:26421) |
| rabeprazole (CHEBI:8768) is a sulfoxide (CHEBI:22063) |
| rabeprazole (CHEBI:8768) is conjugate acid of rabeprazole(1−) (CHEBI:49199) |
| Incoming Relation(s) |
| rabeprazole(1−) (CHEBI:49199) is conjugate base of rabeprazole (CHEBI:8768) |
| IUPAC Name |
|---|
| 2-({[4-(3-methoxypropoxy)-3-methylpyridin-2-yl]methyl}sulfinyl)-1H-benzimidazole |
| INN | Source |
|---|---|
| rabeprazole | ChEBI |
| Synonyms | Source |
|---|---|
| Clofezone | ChemIDplus |
| Rabeprazole | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8159014 | Beilstein |
| CAS:117976-89-3 | ChemIDplus |
| CAS:117976-89-3 | KEGG COMPOUND |