EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | [H][C@@]12C=C[C@@H](C)C[C@]1([H])C2(C)C |
| InChI | InChI=1S/C10H16/c1-7-4-5-8-9(6-7)10(8,2)3/h4-5,7-9H,6H2,1-3H3/t7-,8-,9+/m1/s1 |
| InChIKey | LGNSZMLHOYDATP-HLTSFMKQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-car-4-ene (CHEBI:87676) has parent hydride carane (CHEBI:35663) |
| (−)-car-4-ene (CHEBI:87676) has role metabolite (CHEBI:25212) |
| (−)-car-4-ene (CHEBI:87676) is a monoterpene (CHEBI:35187) |
| IUPAC Name |
|---|
| (1R,4S,6S)-4,7,7-trimethylbicyclo[4.1.0]hept-2-ene |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6090913 | Reaxys |