EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N4O2S.Cl |
| Net Charge | 0 |
| Average Mass | 364.858 |
| Monoisotopic Mass | 364.07607 |
| SMILES | CN(C)c1ccc2nc3ccc(N(C)C)c([N+](=O)[O-])c3[s+]c2c1.[Cl-] |
| InChI | InChI=1S/C16H17N4O2S.ClH/c1-18(2)10-5-6-11-14(9-10)23-16-12(17-11)7-8-13(19(3)4)15(16)20(21)22;/h5-9H,1-4H3;1H/q+1;/p-1 |
| InChIKey | YYGBVRCTHASBKD-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylene green (CHEBI:87675) has part 3,7-bis(dimethylamino)-4-nitrophenothiazin-5-ium (CHEBI:87680) |
| methylene green (CHEBI:87675) has role fluorochrome (CHEBI:51217) |
| methylene green (CHEBI:87675) has role histological dye (CHEBI:77178) |
| methylene green (CHEBI:87675) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 3,7-bis(dimethylamino)-4-nitrophenothiazin-5-ium chloride |
| Synonyms | Source |
|---|---|
| basic green 5 | ChEBI |
| C.I. 52020 | ChEBI |
| C.I. Basic Green 5 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3898566 | Reaxys |
| CAS:2679-01-8 | ChemIDplus |
| Citations |
|---|