EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21N3.HCl |
| Net Charge | 0 |
| Average Mass | 351.881 |
| Monoisotopic Mass | 351.15023 |
| SMILES | Cc1cc(C(=C2C=CC(=N)C=C2)c2ccc(N)c(C)c2)ccc1N.Cl |
| InChI | InChI=1S/C21H21N3.ClH/c1-13-11-16(5-9-19(13)23)21(15-3-7-18(22)8-4-15)17-6-10-20(24)14(2)12-17;/h3-12,22H,23-24H2,1-2H3;1H |
| InChIKey | YCIVZWKFFBDLTG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magenta II (CHEBI:87668) has part magenta II(1+) (CHEBI:87670) |
| magenta II (CHEBI:87668) has role fluorochrome (CHEBI:51217) |
| magenta II (CHEBI:87668) has role histological dye (CHEBI:77178) |
| magenta II (CHEBI:87668) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| basic fuchsin (CHEBI:87661) has part magenta II (CHEBI:87668) |
| IUPAC Names |
|---|
| 4,4'-[(4-iminocyclohexa-2,5-dien-1-ylidene)methylene]bis(2-methylaniline) hydrochloride |
| 4-[bis(4-amino-3-methylphenyl)methylidene]cyclohexa-2,5-dien-1-iminium chloride |
| Synonyms | Source |
|---|---|
| 4-((4-Amino-m-tolyl)(4-iminocyclohexa-2,5-dien-1-ylidene)methyl)-o-toluidine monohydrochloride | ChemIDplus |
| Carbol-fuchsin | ChemIDplus |
| dimethyl fuchsin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18366209 | Reaxys |
| CAS:4197-24-4 | ChemIDplus |
| Citations |
|---|