EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N3.HCl |
| Net Charge | 0 |
| Average Mass | 323.827 |
| Monoisotopic Mass | 323.11893 |
| SMILES | Cl.N=C1C=CC(=C(c2ccc(N)cc2)c2ccc(N)cc2)C=C1 |
| InChI | InChI=1S/C19H17N3.ClH/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15;/h1-12,20H,21-22H2;1H |
| InChIKey | JUQPZRLQQYSMEQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pararosaniline (CHEBI:87663) has part pararosaniline(1+) (CHEBI:87664) |
| pararosaniline (CHEBI:87663) has role fluorochrome (CHEBI:51217) |
| pararosaniline (CHEBI:87663) has role histological dye (CHEBI:77178) |
| pararosaniline (CHEBI:87663) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| basic fuchsin (CHEBI:87661) has part pararosaniline (CHEBI:87663) |
| IUPAC Names |
|---|
| 4,4'-[(4-iminocyclohexa-2,5-dien-1-ylidene)methanediyl]dianiline hydrochloride |
| 4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-iminium chloride |
| Synonyms | Source |
|---|---|
| 4,4'-(4-Iminocyclohexa-2,5-dienylidenemethylene)dianiline hydrochloride | ChemIDplus |
| basic fuchsin | ChEBI |
| Basic parafuchsine | ChemIDplus |
| basic red 9 | ChEBI |
| C.I. 42500 | ChEBI |
| CI 42500 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Pararosaniline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8459648 | Reaxys |
| CAS:569-61-9 | ChemIDplus |
| Citations |
|---|