EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H11N3O3 |
| Net Charge | 0 |
| Average Mass | 293.282 |
| Monoisotopic Mass | 293.08004 |
| SMILES | [H]C(=NNC(=O)c1cccnc1)c1coc2ccccc2c1=O |
| InChI | InChI=1S/C16H11N3O3/c20-15-12(10-22-14-6-2-1-5-13(14)15)9-18-19-16(21)11-4-3-7-17-8-11/h1-10H,(H,19,21) |
| InChIKey | DAVIKTBRCQWOGT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | signal transducer and activator of transcription 5 protein inhibitor Any inhibitor of signal transducer and activator of transcription 5 protein |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N'-[(4-oxo-4H-chromen-3-yl)methylene]nicotinohydrazide (CHEBI:87662) has role signal transducer and activator of transcription 5 protein inhibitor (CHEBI:87786) |
| N'-[(4-oxo-4H-chromen-3-yl)methylene]nicotinohydrazide (CHEBI:87662) is a carbohydrazide (CHEBI:35363) |
| N'-[(4-oxo-4H-chromen-3-yl)methylene]nicotinohydrazide (CHEBI:87662) is a chromones (CHEBI:23238) |
| N'-[(4-oxo-4H-chromen-3-yl)methylene]nicotinohydrazide (CHEBI:87662) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| N'-[(4-oxo-4H-chromen-3-yl)methylene]nicotinohydrazide |
| Synonym | Source |
|---|---|
| STAT5 inhibitor | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:285986-31-4 | SUBMITTER |