EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC[C@@H](C)CO)[C@]1([H])C(=O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C27H44O3/c1-17(16-28)6-5-7-18(2)21-8-9-22-25-23(11-13-27(21,22)4)26(3)12-10-20(29)14-19(26)15-24(25)30/h15,17-18,20-23,25,28-29H,5-14,16H2,1-4H3/t17-,18-,20+,21-,22+,23+,25+,26+,27-/m1/s1 |
| InChIKey | LFNAJBFFWWMSEW-HNFKANRHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21411718) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (25R)-3β,26-dihydroxycholest-5-en-7-one (CHEBI:87653) has functional parent cholesterol (CHEBI:16113) |
| (25R)-3β,26-dihydroxycholest-5-en-7-one (CHEBI:87653) has role human xenobiotic metabolite (CHEBI:76967) |
| (25R)-3β,26-dihydroxycholest-5-en-7-one (CHEBI:87653) is a 26-hydroxy steroid (CHEBI:36852) |
| (25R)-3β,26-dihydroxycholest-5-en-7-one (CHEBI:87653) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| (25R)-3β,26-dihydroxycholest-5-en-7-one (CHEBI:87653) is a 3β-sterol (CHEBI:35348) |
| (25R)-3β,26-dihydroxycholest-5-en-7-one (CHEBI:87653) is a 7-oxo steroid (CHEBI:47789) |
| (25R)-3β,26-dihydroxycholest-5-en-7-one (CHEBI:87653) is a cholestanoid (CHEBI:50401) |
| (25R)-3β,26-dihydroxycholest-5-en-7-one (CHEBI:87653) is a oxysterol (CHEBI:53030) |
| IUPAC Name |
|---|
| (25R)-3β,26-dihydroxycholest-5-en-7-one |
| Synonyms | Source |
|---|---|
| (25R)-7-ketocholest-5-en-3β,27-diol | ChEBI |
| (25R)-7-oxocholest-5-en-3β,27-diol | SUBMITTER |
| (3β,25R)-3,26-dihydroxycholest-5-en-7-one | IUPAC |
| UniProt Name | Source |
|---|---|
| (25R)-3β,26-dihydroxycholest-5-en-7-one | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8368987 | Reaxys |
| Citations |
|---|