EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87651 - victoria blue B
| Formula | C33H32N3.Cl |
| Net Charge | 0 |
| Average Mass | 506.093 |
| Monoisotopic Mass | 505.22848 |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(Nc3ccccc3)c3ccccc23)cc1.[Cl-] |
| InChI | InChI=1S/C33H31N3.ClH/c1-35(2)27-18-14-24(15-19-27)33(25-16-20-28(21-17-25)36(3)4)31-22-23-32(30-13-9-8-12-29(30)31)34-26-10-6-5-7-11-26;/h5-23H,1-4H3;1H |
| InChIKey | LLWJPGAKXJBKKA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| victoria blue B (CHEBI:87651) has part victoria blue B(1+) (CHEBI:87652) |
| victoria blue B (CHEBI:87651) has role fluorochrome (CHEBI:51217) |
| victoria blue B (CHEBI:87651) has role histological dye (CHEBI:77178) |
| victoria blue B (CHEBI:87651) is a iminium salt (CHEBI:35277) |
| victoria blue B (CHEBI:87651) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 4-{(4-anilinonaphthalen-1-yl)[4-(dimethylamino)phenyl]methylidene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium chloride |
| Synonyms | Source |
|---|---|
| (4-((4-Anilino-1-naphthyl)(4-(dimethylamino)phenyl)methylene)cyclohexa-2,5-dien-1-ylidene)dimethylammonium chloride | ChemIDplus |
| basic blue 26 | ChEBI |
| C.I. 44045 | ChEBI |
| C.I. Basic Blue 26 | ChemIDplus |
| victoria blue | ChEBI |
| Victoria Pure Blue B | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3900350 | Reaxys |
| CAS:2580-56-5 | ChemIDplus |
| Citations |
|---|