EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87649 - methyl green
| Formula | C26H33N3.2Cl |
| Net Charge | 0 |
| Average Mass | 458.477 |
| Monoisotopic Mass | 457.20515 |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc([N+](C)(C)C)cc2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C26H33N3.2ClH/c1-27(2)23-14-8-20(9-15-23)26(21-10-16-24(17-11-21)28(3)4)22-12-18-25(19-13-22)29(5,6)7;;/h8-19H,1-7H3;2*1H/q+2;;/p-2 |
| InChIKey | DWCZIOOZPIDHAB-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl green (CHEBI:87649) has part methyl green(2+) (CHEBI:87650) |
| methyl green (CHEBI:87649) has role fluorochrome (CHEBI:51217) |
| methyl green (CHEBI:87649) has role histological dye (CHEBI:77178) |
| methyl green (CHEBI:87649) is a iminium salt (CHEBI:35277) |
| methyl green (CHEBI:87649) is a organic chloride salt (CHEBI:36094) |
| methyl green (CHEBI:87649) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (4-{[4-(dimethylamino)phenyl][4-(trimethylazaniumyl)phenyl]methylidene}cyclohexa-2,5-dien-1-ylidene)(dimethyl)ammonium dichloride |
| Synonyms | Source |
|---|---|
| light green | ChEBI |
| basic blue 20 | ChEBI |
| C.I. 42585 | ChEBI |
| Double green | ChemIDplus |
| 4-((4-(Dimethylamino)phenyl)(4-(dimethyliminio)cyclohexa-2,5-dien-1-ylidene)methyl)-N,N,N-trimethylanilinium dichloride | ChemIDplus |
| C.I. Basic Blue 20 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5208063 | Reaxys |
| CAS:82-94-0 | ChemIDplus |
| Citations |
|---|