EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N3S.Cl |
| Net Charge | 0 |
| Average Mass | 305.834 |
| Monoisotopic Mass | 305.07535 |
| SMILES | Cc1cc2nc3ccc(N(C)C)cc3[s+]c2cc1N.[Cl-] |
| InChI | InChI=1S/C15H16N3S.ClH/c1-9-6-13-15(8-11(9)16)19-14-7-10(18(2)3)4-5-12(14)17-13;/h4-8H,16H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | HNONEKILPDHFOL-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | diagnostic agent A substance administered to aid diagnosis of a disease. fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolonium chloride (CHEBI:87647) has part tolonium (CHEBI:87648) |
| tolonium chloride (CHEBI:87647) has role diagnostic agent (CHEBI:33295) |
| tolonium chloride (CHEBI:87647) has role fluorochrome (CHEBI:51217) |
| tolonium chloride (CHEBI:87647) has role histological dye (CHEBI:77178) |
| tolonium chloride (CHEBI:87647) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 3-amino-7-(dimethylamino)-2-methylphenothiazin-5-ium chloride |
| INNs | Source |
|---|---|
| chlorure de tolonium | ChemIDplus |
| cloruro de tolonio | ChemIDplus |
| tolonii chloridum | ChemIDplus |
| tolonium chloride | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-Amino-7-(dimethylamino)-2-(methylphenazathionium) chloride | ChemIDplus |
| basic blue 17 | ChEBI |
| Blutene chloride | ChemIDplus |
| Ci 52040 | ChEMBL |
| C.I. 52040 | ChEBI |
| C.I. 925 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Blutene | ChEMBL |
| Klot | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| Tolonium_chloride | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3580048 | Reaxys |
| CAS:92-31-9 | ChemIDplus |
| Citations |
|---|