EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H40N3.Cl |
| Net Charge | 0 |
| Average Mass | 562.201 |
| Monoisotopic Mass | 561.29108 |
| SMILES | CCN(CC)c1ccc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2ccc(Nc3ccccc3)c3ccccc23)cc1.[Cl-] |
| InChI | InChI=1S/C37H39N3.ClH/c1-5-39(6-2)31-22-18-28(19-23-31)37(29-20-24-32(25-21-29)40(7-3)8-4)35-26-27-36(34-17-13-12-16-33(34)35)38-30-14-10-9-11-15-30;/h9-27H,5-8H2,1-4H3;1H |
| InChIKey | NTPMRTUYLKDNSS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| night blue (CHEBI:87645) has part night blue(1+) (CHEBI:87646) |
| night blue (CHEBI:87645) has role fluorochrome (CHEBI:51217) |
| night blue (CHEBI:87645) has role histological dye (CHEBI:77178) |
| night blue (CHEBI:87645) is a iminium salt (CHEBI:35277) |
| night blue (CHEBI:87645) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 4-{(4-anilinonaphthalen-1-yl)[4-(diethylamino)phenyl]methylidene}-N,N-diethylcyclohexa-2,5-dien-1-iminium chloride |
| Synonyms | Source |
|---|---|
| basic blue 15 | ChEBI |
| C.I. 44085 | ChEBI |
| C.I. Basic Blue 15 | ChemIDplus |
| NSC 9620 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6113932 | Reaxys |
| CAS:4692-38-0 | ChemIDplus |
| Citations |
|---|