EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87643 - victoria blue 4R
| Formula | C34H34N3.Cl |
| Net Charge | 0 |
| Average Mass | 520.120 |
| Monoisotopic Mass | 519.24413 |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(C)c3ccccc3)c3ccccc23)cc1.[Cl-] |
| InChI | InChI=1S/C34H34N3.ClH/c1-35(2)27-19-15-25(16-20-27)34(26-17-21-28(22-18-26)36(3)4)32-23-24-33(31-14-10-9-13-30(31)32)37(5)29-11-7-6-8-12-29;/h6-24H,1-5H3;1H/q+1;/p-1 |
| InChIKey | AODQPPLFAXTBJS-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| victoria blue 4R (CHEBI:87643) has part victoria blue 4R(1+) (CHEBI:87644) |
| victoria blue 4R (CHEBI:87643) has role fluorochrome (CHEBI:51217) |
| victoria blue 4R (CHEBI:87643) has role histological dye (CHEBI:77178) |
| victoria blue 4R (CHEBI:87643) is a iminium salt (CHEBI:35277) |
| victoria blue 4R (CHEBI:87643) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 4-([4-(dimethylamino)phenyl]{4-[methyl(phenyl)amino]naphthalen-1-yl}methylidene)-N,N-dimethylcyclohexa-2,5-dien-1-iminium chloride |
| Synonyms | Source |
|---|---|
| (4-((4-(Dimethylamino)phenyl)(4-toluidino-1-naphthyl)methylene)cyclohexa-2,5-dien-1-ylidene)dimethylammonium chloride | ChemIDplus |
| basic blue 8 | ChEBI |
| C.I. 42563 | ChEBI |
| C.I. Basic Blue 8 | ChemIDplus |
| Victoria Basic Blue F4R | ChemIDplus |
| victoria blue | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8962441 | Reaxys |
| CAS:2185-87-7 | ChemIDplus |
| Citations |
|---|