EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N3S.Cl |
| Net Charge | 0 |
| Average Mass | 277.780 |
| Monoisotopic Mass | 277.04405 |
| SMILES | CNc1ccc2nc3ccc(N)cc3[s+]c2c1.[Cl-] |
| InChI | InChI=1S/C13H12N3S.ClH/c1-15-9-3-5-11-13(7-9)17-12-6-8(14)2-4-10(12)16-11;/h2-7,15H,14H2,1H3;1H/q+1;/p-1 |
| InChIKey | OBKVLZKRUVYQNQ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azure C (CHEBI:87641) has part 3-amino-7-(methylamino)phenothiazin-5-ium (CHEBI:87642) |
| azure C (CHEBI:87641) has role fluorochrome (CHEBI:51217) |
| azure C (CHEBI:87641) has role histological dye (CHEBI:77178) |
| azure C (CHEBI:87641) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 3-amino-7-(methylamino)phenothiazin-5-ium chloride |
| Synonyms | Source |
|---|---|
| 3-Amino-7-methylaminophenothiazin-5-ium chloride | ChemIDplus |
| C.I. 52002 | ChEBI |
| Methylene Azure C | ChemIDplus |
| Monomethyldiaminodiphenazothionium chloride | ChemIDplus |
| Monomethylthionine | ChemIDplus |
| Monomethylthionine chloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4060661 | Reaxys |
| CAS:531-57-7 | ChemIDplus |
| Citations |
|---|