EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N3S.Cl |
| Net Charge | 0 |
| Average Mass | 305.834 |
| Monoisotopic Mass | 305.07535 |
| SMILES | CNc1ccc2nc3ccc(N(C)C)cc3[s+]c2c1.[Cl-] |
| InChI | InChI=1S/C15H16N3S.ClH/c1-16-10-4-6-12-14(8-10)19-15-9-11(18(2)3)5-7-13(15)17-12;/h4-9,16H,1-3H3;1H/q+1;/p-1 |
| InChIKey | KFZNPGQYVZZSNV-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24161345) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azure B (CHEBI:87639) has part 3-(dimethylamino)-7-(methylamino)phenothiazin-5-ium (CHEBI:87640) |
| azure B (CHEBI:87639) has role antidepressant (CHEBI:35469) |
| azure B (CHEBI:87639) has role cardioprotective agent (CHEBI:77307) |
| azure B (CHEBI:87639) has role drug metabolite (CHEBI:49103) |
| azure B (CHEBI:87639) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| azure B (CHEBI:87639) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| azure B (CHEBI:87639) has role fluorochrome (CHEBI:51217) |
| azure B (CHEBI:87639) has role histological dye (CHEBI:77178) |
| azure B (CHEBI:87639) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 3-(dimethylamino)-7-(methylamino)phenothiazin-5-ium chloride |
| Synonyms | Source |
|---|---|
| 3-(Dimethylamino)-7-(methylimino)-3H-phenothiazine hydrochloride | ChemIDplus |
| 3-Methylamino-7-dimethylaminophenzathonium chloride | ChemIDplus |
| C.I. 52010 | ChEBI |
| methylene azure B | ChEBI |
| Trimethylthionine chloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3922630 | Reaxys |
| CAS:531-55-5 | ChemIDplus |
| Citations |
|---|