EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N3S.Cl |
| Net Charge | 0 |
| Average Mass | 305.834 |
| Monoisotopic Mass | 305.07535 |
| SMILES | CNc1ccc2nc3ccc(N(C)C)cc3[s+]c2c1.[Cl-] |
| InChI | InChI=1S/C15H16N3S.ClH/c1-16-10-4-6-12-14(8-10)19-15-9-11(18(2)3)5-7-13(15)17-12;/h4-9,16H,1-3H3;1H/q+1;/p-1 |
| InChIKey | KFZNPGQYVZZSNV-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24161345) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. cardioprotective agent Any protective agent that is able to prevent damage to the heart. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azure B (CHEBI:87639) has part 3-(dimethylamino)-7-(methylamino)phenothiazin-5-ium (CHEBI:87640) |
| azure B (CHEBI:87639) has role antidepressant (CHEBI:35469) |
| azure B (CHEBI:87639) has role cardioprotective agent (CHEBI:77307) |
| azure B (CHEBI:87639) has role drug metabolite (CHEBI:49103) |
| azure B (CHEBI:87639) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| azure B (CHEBI:87639) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| azure B (CHEBI:87639) has role fluorochrome (CHEBI:51217) |
| azure B (CHEBI:87639) has role histological dye (CHEBI:77178) |
| azure B (CHEBI:87639) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 3-(dimethylamino)-7-(methylamino)phenothiazin-5-ium chloride |
| Synonyms | Source |
|---|---|
| 3-(Dimethylamino)-7-(methylimino)-3H-phenothiazine hydrochloride | ChemIDplus |
| 3-Methylamino-7-dimethylaminophenzathonium chloride | ChemIDplus |
| C.I. 52010 | ChEBI |
| methylene azure B | ChEBI |
| Trimethylthionine chloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3922630 | Reaxys |
| CAS:531-55-5 | ChemIDplus |
| Citations |
|---|