EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N3S.Cl |
| Net Charge | 0 |
| Average Mass | 291.807 |
| Monoisotopic Mass | 291.05970 |
| SMILES | CN(C)c1ccc2nc3ccc(N)cc3[s+]c2c1.[Cl-] |
| InChI | InChI=1S/C14H14N3S.ClH/c1-17(2)10-4-6-12-14(8-10)18-13-7-9(15)3-5-11(13)16-12;/h3-8H,15H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PGWTYMLATMNCCZ-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azure A (CHEBI:87637) has part 3-amino-7-(dimethylamino)phenothiazin-5-ium (CHEBI:87638) |
| azure A (CHEBI:87637) has role fluorochrome (CHEBI:51217) |
| azure A (CHEBI:87637) has role histological dye (CHEBI:77178) |
| azure A (CHEBI:87637) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 3-amino-7-(dimethylamino)phenothiazin-5-ium chloride |
| Synonyms | Source |
|---|---|
| 3-Amino-7-dimethylaminophenazathionium chloride | ChemIDplus |
| Azur A | ChemIDplus |
| C.I. 52005 | ChEBI |
| Dimethylthionine | ChemIDplus |
| methylene azure A | ChEBI |
| N,N-Dimethylthionine | ChemIDplus |
| Citations |
|---|