EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O3 |
| Net Charge | 0 |
| Average Mass | 286.371 |
| Monoisotopic Mass | 286.15689 |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@]1([H])c3ccc(O)cc3[C@H](O)C[C@@]21[H] |
| InChI | InChI=1S/C18H22O3/c1-18-7-6-12-11-3-2-10(19)8-14(11)16(20)9-13(12)15(18)4-5-17(18)21/h2-3,8,12-13,15-16,19-20H,4-7,9H2,1H3/t12-,13-,15+,16-,18+/m1/s1 |
| InChIKey | HTORTGVWUGQTHQ-UHOVARLQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (9192820) |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6β-hydroxyestrone (CHEBI:87626) has functional parent estrone (CHEBI:17263) |
| 6β-hydroxyestrone (CHEBI:87626) has parent hydride estrane (CHEBI:23966) |
| 6β-hydroxyestrone (CHEBI:87626) has role human xenobiotic metabolite (CHEBI:76967) |
| 6β-hydroxyestrone (CHEBI:87626) has role mouse metabolite (CHEBI:75771) |
| 6β-hydroxyestrone (CHEBI:87626) is a 17-oxo steroid (CHEBI:19168) |
| 6β-hydroxyestrone (CHEBI:87626) is a 3-hydroxy steroid (CHEBI:36834) |
| 6β-hydroxyestrone (CHEBI:87626) is a 6β-hydroxy steroid (CHEBI:36851) |
| 6β-hydroxyestrone (CHEBI:87626) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3,6β-dihydroxy-estra-1,3,5(10)-trien-17-one |
| Synonym | Source |
|---|---|
| (6β)-3,6-dihydroxyestra-1,3,5(10)-trien-17-one | IUPAC |
| UniProt Name | Source |
|---|---|
| 6β-hydroxyestrone | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6904811 | Reaxys |
| Citations |
|---|