EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O3 |
| Net Charge | 0 |
| Average Mass | 288.387 |
| Monoisotopic Mass | 288.17254 |
| SMILES | [H][C@@]12CCc3cc(O)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](O)[C@@H](O)C[C@@]21[H] |
| InChI | InChI=1S/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16+,17+,18+/m1/s1 |
| InChIKey | PROQIPRRNZUXQM-ZMSHIADSSA-N |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16β-hydroxyestradiol (CHEBI:87620) has functional parent 17β-estradiol (CHEBI:16469) |
| 16β-hydroxyestradiol (CHEBI:87620) has parent hydride estrane (CHEBI:23966) |
| 16β-hydroxyestradiol (CHEBI:87620) has role anti-inflammatory drug (CHEBI:35472) |
| 16β-hydroxyestradiol (CHEBI:87620) has role human xenobiotic metabolite (CHEBI:76967) |
| 16β-hydroxyestradiol (CHEBI:87620) is a 16β-hydroxy steroid (CHEBI:17354) |
| 16β-hydroxyestradiol (CHEBI:87620) is a 17β-hydroxy steroid (CHEBI:35343) |
| 16β-hydroxyestradiol (CHEBI:87620) is a 3-hydroxy steroid (CHEBI:36834) |
| 16β-hydroxyestradiol (CHEBI:87620) is a phenolic steroid (CHEBI:177917) |
| 16β-hydroxyestradiol (CHEBI:87620) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| 16-epiestriol 16-O-(β-D-glucuronide) (CHEBI:137723) has functional parent 16β-hydroxyestradiol (CHEBI:87620) |
| 16-epiestriol 3-O-(β-D-glucuronide) (CHEBI:137720) has functional parent 16β-hydroxyestradiol (CHEBI:87620) |
| IUPAC Names |
|---|
| (16β,17β)-estra-1(10),2,4-triene-3,16,17-triol |
| estra-1(10),2,4-triene-3,16β,17β-triol |
| INNs | Source |
|---|---|
| epiestriol | ChemIDplus |
| epiestriolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| estra-1,3,5(10)-triene-3,16β,17β-triol | SUBMITTER |
| Actriol | HMDB |
| 16-Epiestriol | HMDB |
| estra-1,3,5(10)-triene-3,16β,17-triol | HMDB |
| 16β,17β-estriol | HMDB |
| Epioestriolum | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 16β,17β-estriol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000347 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3210437 | Reaxys |
| CAS:547-81-9 | ChemIDplus |
| Citations |
|---|