EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O3 |
| Net Charge | 0 |
| Average Mass | 286.371 |
| Monoisotopic Mass | 286.15689 |
| SMILES | [H][C@@]12CCc3cc(O)ccc3[C@@]1([H])CC[C@]1(C)C(=O)C[C@H](O)[C@@]21[H] |
| InChI | InChI=1S/C18H22O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)17(18)15(20)9-16(18)21/h3,5,8,13-15,17,19-20H,2,4,6-7,9H2,1H3/t13-,14-,15+,17-,18-/m1/s1 |
| InChIKey | FDFNTZDUOBCJMD-DMHIMHRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium verticillioides (ncbitaxon:117187) | - | PubMed (5866044) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (12865317) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. fungal xenobiotic metabolite Any fungal metabolite produced by metabolism of a xenobiotic compound in fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15α-hydroxyestrone (CHEBI:87618) has functional parent estrone (CHEBI:17263) |
| 15α-hydroxyestrone (CHEBI:87618) has parent hydride estrane (CHEBI:23966) |
| 15α-hydroxyestrone (CHEBI:87618) has role fungal xenobiotic metabolite (CHEBI:76968) |
| 15α-hydroxyestrone (CHEBI:87618) has role human xenobiotic metabolite (CHEBI:76967) |
| 15α-hydroxyestrone (CHEBI:87618) is a 15α-hydroxy steroid (CHEBI:83147) |
| 15α-hydroxyestrone (CHEBI:87618) is a 17-oxo steroid (CHEBI:19168) |
| 15α-hydroxyestrone (CHEBI:87618) is a 3-hydroxy steroid (CHEBI:36834) |
| 15α-hydroxyestrone (CHEBI:87618) is a phenolic steroid (CHEBI:177917) |
| 15α-hydroxyestrone (CHEBI:87618) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3,15α-dihydroxyestra-1,3,5(10)-trien-17-one |
| Synonyms | Source |
|---|---|
| (15α)-3,15-dihydroxyestra-1,3,5(10)-trien-17-one | IUPAC |
| 15α-hydroxyoestrone | ChEBI |
| UniProt Name | Source |
|---|---|
| 15α-hydroxyestrone | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2625341 | Reaxys |
| Citations |
|---|