EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O3 |
| Net Charge | 0 |
| Average Mass | 286.371 |
| Monoisotopic Mass | 286.15689 |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@]1([H])c3ccc(O)c(O)c3CC[C@@]21[H] |
| InChI | InChI=1S/C18H22O3/c1-18-9-8-11-10-4-6-15(19)17(21)13(10)3-2-12(11)14(18)5-7-16(18)20/h4,6,11-12,14,19,21H,2-3,5,7-9H2,1H3/t11-,12-,14+,18+/m1/s1 |
| InChIKey | XQZVQQZZOVBNLU-QDTBLXIISA-N |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. estrogen A hormone that stimulates or controls the development and maintenance of female sex characteristics in mammals by binding to oestrogen receptors. The oestrogens are named for their importance in the oestrous cycle. The oestrogens that occur naturally in the body, notably estrone, estradiol, estriol, and estetrol are steroids. Other compounds with oestrogenic activity are produced by plants (phytoestrogens) and fungi (mycoestrogens); synthetic compounds with oestrogenic activity are known as xenoestrogens. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxyestrone (CHEBI:87602) has functional parent estrone (CHEBI:17263) |
| 4-hydroxyestrone (CHEBI:87602) has role carcinogenic agent (CHEBI:50903) |
| 4-hydroxyestrone (CHEBI:87602) has role estrogen (CHEBI:50114) |
| 4-hydroxyestrone (CHEBI:87602) has role human urinary metabolite (CHEBI:84087) |
| 4-hydroxyestrone (CHEBI:87602) is a 17-oxo steroid (CHEBI:19168) |
| 4-hydroxyestrone (CHEBI:87602) is a 3-hydroxy steroid (CHEBI:36834) |
| 4-hydroxyestrone (CHEBI:87602) is a 4-hydroxy steroid (CHEBI:62846) |
| 4-hydroxyestrone (CHEBI:87602) is a catechols (CHEBI:33566) |
| 4-hydroxyestrone (CHEBI:87602) is a phenolic steroid (CHEBI:177917) |
| Incoming Relation(s) |
| 4-hydroxyestrone 3-O-(β-D-glucuronide) (CHEBI:137960) has functional parent 4-hydroxyestrone (CHEBI:87602) |
| 4-hydroxyestrone 4-O-(β-D-glucuronide) (CHEBI:137961) has functional parent 4-hydroxyestrone (CHEBI:87602) |
| IUPAC Name |
|---|
| 3,4-dihydroxyestra-1,3,5(10)-trien-17-one |
| Synonyms | Source |
|---|---|
| 3,4-dihydroxy-estra-1,3,5(10)-trien-17-one | SUBMITTER |
| estra-1,3,5(10)-triene-3,4-diol-17-one | HMDB |
| UniProt Name | Source |
|---|---|
| 4-hydroxyestrone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0005895 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2221832 | Reaxys |
| CAS:3131-23-5 | ChemIDplus |
| Citations |
|---|