EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26 |
| Net Charge | 0 |
| Average Mass | 218.384 |
| Monoisotopic Mass | 218.20345 |
| SMILES | CCCCCCCC(CC)c1ccccc1 |
| InChI | InChI=1S/C16H26/c1-3-5-6-7-9-12-15(4-2)16-13-10-8-11-14-16/h8,10-11,13-15H,3-7,9,12H2,1-2H3 |
| InChIKey | PYVIFMPVFLOTLN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-phenyldecane (CHEBI:87601) has role metabolite (CHEBI:25212) |
| 3-phenyldecane (CHEBI:87601) is a benzenes (CHEBI:22712) |
| IUPAC Name |
|---|
| (decan-3-yl)benzene |
| Synonym | Source |
|---|---|
| (1-ethyloctyl)benzene | ChemIDplus |